About methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate
methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate (PubChem CID 68930217) has the molecular formula C19H20N2O5
and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate |
| PubChem CID | 68930217 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate |
| SMILES | CCc1cc(-n2c(=O)[nH]c3cc(C(=O)OC)ccc32)c(OC)cc1OC |
| InChI | InChI=1S/C19H20N2O5/c1-5-11-9-15(17(25-3)10-16(11)24-2)21-14-7-6-12(18(22)26-4)8-13(14)20-19(21)23/h6-10H,5H2,1-4H3,(H,20,23) |
| InChIKey | OKSFCFIWPPEVFN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate?
The IUPAC name of methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate (CID 68930217) is methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate.
What is the SMILES notation for methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate?
The canonical SMILES for methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate is CCc1cc(-n2c(=O)[nH]c3cc(C(=O)OC)ccc32)c(OC)cc1OC.
What is the InChIKey of methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate?
The InChIKey is OKSFCFIWPPEVFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O5/c1-5-11-9-15(17(25-3)10-16(11)24-2)21-14-7-6-12(18(22)26-4)8-13(14)20-19(21)23/h6-10H,5H2,1-4H3,(H,20,23).
What are the key properties of methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate?
methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate has a molecular weight of 356.38 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(5-ethyl-2,4-dimethoxyphenyl)-2-oxo-3H-benzimidazole-5-carboxylate is sourced from PubChem (CID 68930217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).