C31H33Cl3N4O4 — CID 68932315
tert-butyl N-[2-[(3R,4R)-4-[(4-chlorobenzoyl)-methylamino]-3-(3,4-dichlorophenyl)piperidine-1-carbonyl]anilino]carbamate (PubChem CID 68932315) has the molecular formula C31H33Cl3N4O4 and a molecular weight of 631.99 g/mol. Its IUPAC name is tert-butyl N-[2-[(3R,4R)-4-[(4-chlorobenzoyl)-methylamino]-3-(3,4-dichlorophenyl)piperidine-1-carbonyl]anilino]carbamate.
| Compound Name | tert-butyl N-[2-[(3R,4R)-4-[(4-chlorobenzoyl)-methylamino]-3-(3,4-dichlorophenyl)piperidine-1-carbonyl]anilino]carbamate |
|---|---|
| PubChem CID | 68932315 |
| Molecular Formula | C31H33Cl3N4O4 |
| Molecular Weight | 631.99 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | tert-butyl N-[2-[(3R,4R)-4-[(4-chlorobenzoyl)-methylamino]-3-(3,4-dichlorophenyl)piperidine-1-carbonyl]anilino]carbamate |
| SMILES | CN(C(=O)c1ccc(Cl)cc1)[C@@H]1CCN(C(=O)c2ccccc2NNC(=O)OC(C)(C)C)C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C31H33Cl3N4O4/c1-31(2,3)42-30(41)36-35-26-8-6-5-7-22(26)29(40)38-16-15-27(23(18-38)20-11-14-24(33)25(34)17-20)37(4)28(39)19-9-12-21(32)13-10-19/h5-14,17,23,27,35H,15-16,18H2,1-4H3,(H,36,41)/t23-,27+/m0/s1 |
| InChIKey | KEFBQKWMBAXBMN-WNCULLNHSA-N |
| XLogP | 7.27 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.99 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|