C7H13ClN2 — CID 68934689
3,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-amine;hydrochloride (PubChem CID 68934689) has the molecular formula C7H13ClN2 and a molecular weight of 160.65 g/mol. Its IUPAC name is 3,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-amine;hydrochloride.
| Compound Name | 3,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 68934689 |
| Molecular Formula | C7H13ClN2 |
| Molecular Weight | 160.65 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 3,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-amine;hydrochloride |
| SMILES | Cl.NN1CC2=CCCC2C1 |
| InChI | InChI=1S/C7H12N2.ClH/c8-9-4-6-2-1-3-7(6)5-9;/h2,7H,1,3-5,8H2;1H |
| InChIKey | JTRJHFNBFJFSIA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.65 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|