C35H27F3N2O3 — CID 68936978
3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-4-ylmethyl)-7-[2-(trifluoromethyl)phenyl]indole-2-carboxylic acid (PubChem CID 68936978) has the molecular formula C35H27F3N2O3 and a molecular weight of 580.61 g/mol. Its IUPAC name is 3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-4-ylmethyl)-7-[2-(trifluoromethyl)phenyl]indole-2-carboxylic acid.
| Compound Name | 3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-4-ylmethyl)-7-[2-(trifluoromethyl)phenyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68936978 |
| Molecular Formula | C35H27F3N2O3 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-4-ylmethyl)-7-[2-(trifluoromethyl)phenyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(CCCOc2cccc3ccccc23)c2cccc(-c3ccccc3C(F)(F)F)c2n1Cc1ccncc1 |
| InChI | InChI=1S/C35H27F3N2O3/c36-35(37,38)30-15-4-3-11-26(30)27-12-6-13-28-29(14-7-21-43-31-16-5-9-24-8-1-2-10-25(24)31)33(34(41)42)40(32(27)28)22-23-17-19-39-20-18-23/h1-6,8-13,15-20H,7,14,21-22H2,(H,41,42) |
| InChIKey | ZKKVKXSZDPFSDK-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|