C28H32N4O3S — CID 68940539
N-[3-[1-hydroxy-1-[[2-methyl-4-(4-phenylimidazol-1-yl)butan-2-yl]amino]ethyl]phenyl]benzenesulfonamide (PubChem CID 68940539) has the molecular formula C28H32N4O3S and a molecular weight of 504.66 g/mol. Its IUPAC name is N-[3-[1-hydroxy-1-[[2-methyl-4-(4-phenylimidazol-1-yl)butan-2-yl]amino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[1-hydroxy-1-[[2-methyl-4-(4-phenylimidazol-1-yl)butan-2-yl]amino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 68940539 |
| Molecular Formula | C28H32N4O3S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | N-[3-[1-hydroxy-1-[[2-methyl-4-(4-phenylimidazol-1-yl)butan-2-yl]amino]ethyl]phenyl]benzenesulfonamide |
| SMILES | CC(C)(CCn1cnc(-c2ccccc2)c1)NC(C)(O)c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C28H32N4O3S/c1-27(2,17-18-32-20-26(29-21-32)22-11-6-4-7-12-22)31-28(3,33)23-13-10-14-24(19-23)30-36(34,35)25-15-8-5-9-16-25/h4-16,19-21,30-31,33H,17-18H2,1-3H3 |
| InChIKey | LHOGXNOEDDXQQD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|