C18H16FNO — CID 68941446
3-(4-fluoro-3-methylphenyl)-N-(2-phenylethyl)prop-2-ynamide (PubChem CID 68941446) has the molecular formula C18H16FNO and a molecular weight of 281.33 g/mol. Its IUPAC name is 3-(4-fluoro-3-methylphenyl)-N-(2-phenylethyl)prop-2-ynamide.
| Compound Name | 3-(4-fluoro-3-methylphenyl)-N-(2-phenylethyl)prop-2-ynamide |
|---|---|
| PubChem CID | 68941446 |
| Molecular Formula | C18H16FNO |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(4-fluoro-3-methylphenyl)-N-(2-phenylethyl)prop-2-ynamide |
| SMILES | Cc1cc(C#CC(=O)NCCc2ccccc2)ccc1F |
| InChI | InChI=1S/C18H16FNO/c1-14-13-16(7-9-17(14)19)8-10-18(21)20-12-11-15-5-3-2-4-6-15/h2-7,9,13H,11-12H2,1H3,(H,20,21) |
| InChIKey | CICIFACBYJFZDN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|