C29H37NO3 — CID 68946728
3-methyl-4-(4-octylphenyl)benzoic acid;2-pyridin-2-ylethanol (PubChem CID 68946728) has the molecular formula C29H37NO3 and a molecular weight of 447.62 g/mol. Its IUPAC name is 3-methyl-4-(4-octylphenyl)benzoic acid;2-pyridin-2-ylethanol.
| Compound Name | 3-methyl-4-(4-octylphenyl)benzoic acid;2-pyridin-2-ylethanol |
|---|---|
| PubChem CID | 68946728 |
| Molecular Formula | C29H37NO3 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | 3-methyl-4-(4-octylphenyl)benzoic acid;2-pyridin-2-ylethanol |
| SMILES | CCCCCCCCc1ccc(-c2ccc(C(=O)O)cc2C)cc1.OCCc1ccccn1 |
| InChI | InChI=1S/C22H28O2.C7H9NO/c1-3-4-5-6-7-8-9-18-10-12-19(13-11-18)21-15-14-20(22(23)24)16-17(21)2;9-6-4-7-3-1-2-5-8-7/h10-16H,3-9H2,1-2H3,(H,23,24);1-3,5,9H,4,6H2 |
| InChIKey | BRPPEDSJDGZRBT-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|