About (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one
(3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one (PubChem CID 68946949) has the molecular formula C12H25N3O3
and a molecular weight of 259.35 g/mol. Its IUPAC name is (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one.
Molecular Properties
| Compound Name | (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one |
| PubChem CID | 68946949 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one |
| SMILES | CN1CCN(C(=O)C[C@H](O)C[C@H](O)CCN)CC1 |
| InChI | InChI=1S/C12H25N3O3/c1-14-4-6-15(7-5-14)12(18)9-11(17)8-10(16)2-3-13/h10-11,16-17H,2-9,13H2,1H3/t10-,11-/m1/s1 |
| InChIKey | NOAHTVDVBVDAGJ-GHMZBOCLSA-N |
| XLogP | -1.39 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one?
The IUPAC name of (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one (CID 68946949) is (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one.
What is the SMILES notation for (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one?
The canonical SMILES for (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one is CN1CCN(C(=O)C[C@H](O)C[C@H](O)CCN)CC1.
What is the InChIKey of (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one?
The InChIKey is NOAHTVDVBVDAGJ-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H25N3O3/c1-14-4-6-15(7-5-14)12(18)9-11(17)8-10(16)2-3-13/h10-11,16-17H,2-9,13H2,1H3/t10-,11-/m1/s1.
What are the key properties of (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one?
(3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one has a molecular weight of 259.35 g/mol, XLogP of -1.39, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-7-amino-3,5-dihydroxy-1-(4-methylpiperazin-1-yl)heptan-1-one is sourced from PubChem (CID 68946949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).