C17H14ClFN4O2 — CID 68948288
ethyl 5-(2-aminopyrimidin-4-yl)-2-(2-chloro-4-fluorophenyl)-1H-pyrrole-3-carboxylate (PubChem CID 68948288) has the molecular formula C17H14ClFN4O2 and a molecular weight of 360.78 g/mol. Its IUPAC name is ethyl 5-(2-aminopyrimidin-4-yl)-2-(2-chloro-4-fluorophenyl)-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-(2-aminopyrimidin-4-yl)-2-(2-chloro-4-fluorophenyl)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 68948288 |
| Molecular Formula | C17H14ClFN4O2 |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | ethyl 5-(2-aminopyrimidin-4-yl)-2-(2-chloro-4-fluorophenyl)-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccnc(N)n2)[nH]c1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H14ClFN4O2/c1-2-25-16(24)11-8-14(13-5-6-21-17(20)23-13)22-15(11)10-4-3-9(19)7-12(10)18/h3-8,22H,2H2,1H3,(H2,20,21,23) |
| InChIKey | CMDVNTVAUOUCKW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |