C22H35NO2 — CID 68949329
(1R,3R)-3-methoxy-1'-octylspiro[3,4-dihydroisochromene-1,3'-piperidine] (PubChem CID 68949329) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is (1R,3R)-3-methoxy-1'-octylspiro[3,4-dihydroisochromene-1,3'-piperidine].
| Compound Name | (1R,3R)-3-methoxy-1'-octylspiro[3,4-dihydroisochromene-1,3'-piperidine] |
|---|---|
| PubChem CID | 68949329 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | (1R,3R)-3-methoxy-1'-octylspiro[3,4-dihydroisochromene-1,3'-piperidine] |
| SMILES | CCCCCCCCN1CCC[C@@]2(C1)O[C@@H](OC)Cc1ccccc12 |
| InChI | InChI=1S/C22H35NO2/c1-3-4-5-6-7-10-15-23-16-11-14-22(18-23)20-13-9-8-12-19(20)17-21(24-2)25-22/h8-9,12-13,21H,3-7,10-11,14-18H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | HTRKTSJTSDWJCY-YADHBBJMSA-N |
| XLogP | 4.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|