C17H18Cl2N2O4 — CID 68951481
(2R)-1-(3,4-dichloro-N-ethylanilino)-3-(4-nitrophenoxy)propan-2-ol (PubChem CID 68951481) has the molecular formula C17H18Cl2N2O4 and a molecular weight of 385.25 g/mol. Its IUPAC name is (2R)-1-(3,4-dichloro-N-ethylanilino)-3-(4-nitrophenoxy)propan-2-ol.
| Compound Name | (2R)-1-(3,4-dichloro-N-ethylanilino)-3-(4-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 68951481 |
| Molecular Formula | C17H18Cl2N2O4 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | (2R)-1-(3,4-dichloro-N-ethylanilino)-3-(4-nitrophenoxy)propan-2-ol |
| SMILES | CCN(C[C@@H](O)COc1ccc([N+](=O)[O-])cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O4/c1-2-20(13-5-8-16(18)17(19)9-13)10-14(22)11-25-15-6-3-12(4-7-15)21(23)24/h3-9,14,22H,2,10-11H2,1H3/t14-/m1/s1 |
| InChIKey | TZRHAYAQLNOFKR-CQSZACIVSA-N |
| XLogP | 4.17 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|