C17H16F3N3O6 — CID 60524049
1-(N-methyl-2,4-dinitroanilino)-3-[4-(trifluoromethyl)phenoxy]propan-2-ol (PubChem CID 60524049) has the molecular formula C17H16F3N3O6 and a molecular weight of 415.32 g/mol. Its IUPAC name is 1-(N-methyl-2,4-dinitroanilino)-3-[4-(trifluoromethyl)phenoxy]propan-2-ol.
| Compound Name | 1-(N-methyl-2,4-dinitroanilino)-3-[4-(trifluoromethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 60524049 |
| Molecular Formula | C17H16F3N3O6 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-(N-methyl-2,4-dinitroanilino)-3-[4-(trifluoromethyl)phenoxy]propan-2-ol |
| SMILES | CN(CC(O)COc1ccc(C(F)(F)F)cc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16F3N3O6/c1-21(15-7-4-12(22(25)26)8-16(15)23(27)28)9-13(24)10-29-14-5-2-11(3-6-14)17(18,19)20/h2-8,13,24H,9-10H2,1H3 |
| InChIKey | GNTDMCOZRKHSSQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|