C18H20F3N3O4 — CID 47084473
1-(dimethylamino)-3-[4-[2-nitro-4-(trifluoromethyl)anilino]phenoxy]propan-2-ol (PubChem CID 47084473) has the molecular formula C18H20F3N3O4 and a molecular weight of 399.37 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[4-[2-nitro-4-(trifluoromethyl)anilino]phenoxy]propan-2-ol.
| Compound Name | 1-(dimethylamino)-3-[4-[2-nitro-4-(trifluoromethyl)anilino]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 47084473 |
| Molecular Formula | C18H20F3N3O4 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-(dimethylamino)-3-[4-[2-nitro-4-(trifluoromethyl)anilino]phenoxy]propan-2-ol |
| SMILES | CN(C)CC(O)COc1ccc(Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20F3N3O4/c1-23(2)10-14(25)11-28-15-6-4-13(5-7-15)22-16-8-3-12(18(19,20)21)9-17(16)24(26)27/h3-9,14,22,25H,10-11H2,1-2H3 |
| InChIKey | FIKXITXQZJVLCG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|