C17H18F3N3O6S — CID 55865859
4-[[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-methylamino]-3-nitrobenzenesulfonamide (PubChem CID 55865859) has the molecular formula C17H18F3N3O6S and a molecular weight of 449.41 g/mol. Its IUPAC name is 4-[[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55865859 |
| Molecular Formula | C17H18F3N3O6S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 4-[[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-methylamino]-3-nitrobenzenesulfonamide |
| SMILES | CN(CC(O)COc1ccc(C(F)(F)F)cc1)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18F3N3O6S/c1-22(15-7-6-14(30(21,27)28)8-16(15)23(25)26)9-12(24)10-29-13-4-2-11(3-5-13)17(18,19)20/h2-8,12,24H,9-10H2,1H3,(H2,21,27,28) |
| InChIKey | SNHIAJHFWFYRSJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|