C13H19F3N2O2S — CID 133321695
4-[methyl(2-methylbutyl)amino]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 133321695) has the molecular formula C13H19F3N2O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 4-[methyl(2-methylbutyl)amino]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[methyl(2-methylbutyl)amino]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133321695 |
| Molecular Formula | C13H19F3N2O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-[methyl(2-methylbutyl)amino]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCC(C)CN(C)c1ccc(S(N)(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2O2S/c1-4-9(2)8-18(3)12-6-5-10(21(17,19)20)7-11(12)13(14,15)16/h5-7,9H,4,8H2,1-3H3,(H2,17,19,20) |
| InChIKey | KBKHRGPIRKEERN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |