C14H21N3O6 — CID 11616840
1-(2,4-dinitro-N-propylanilino)-3-methylbutane-2,3-diol (PubChem CID 11616840) has the molecular formula C14H21N3O6 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-(2,4-dinitro-N-propylanilino)-3-methylbutane-2,3-diol.
| Compound Name | 1-(2,4-dinitro-N-propylanilino)-3-methylbutane-2,3-diol |
|---|---|
| PubChem CID | 11616840 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-(2,4-dinitro-N-propylanilino)-3-methylbutane-2,3-diol |
| SMILES | CCCN(CC(O)C(C)(C)O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O6/c1-4-7-15(9-13(18)14(2,3)19)11-6-5-10(16(20)21)8-12(11)17(22)23/h5-6,8,13,18-19H,4,7,9H2,1-3H3 |
| InChIKey | TUMQQXGUAKHKSH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|