C11H14N3O4Y- — CID 59325886
N-ethyl-2,4-dinitro-N-propylaniline;yttrium (PubChem CID 59325886) has the molecular formula C11H14N3O4Y- and a molecular weight of 341.16 g/mol. Its IUPAC name is N-ethyl-2,4-dinitro-N-propylaniline;yttrium.
| Compound Name | N-ethyl-2,4-dinitro-N-propylaniline;yttrium |
|---|---|
| PubChem CID | 59325886 |
| Molecular Formula | C11H14N3O4Y- |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | N-ethyl-2,4-dinitro-N-propylaniline;yttrium |
| SMILES | [CH2-]CN(CCC)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].[Y] |
| InChI | InChI=1S/C11H14N3O4.Y/c1-3-7-12(4-2)10-6-5-9(13(15)16)8-11(10)14(17)18;/h5-6,8H,2-4,7H2,1H3;/q-1; |
| InChIKey | PUOLVTBDXYAGBB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|