C20H28N4O2 — CID 68952134
2-[(1R,5R)-6-(5-hydroxypentyl)-6-azabicyclo[3.2.1]octan-5-yl]-1H-benzimidazole-4-carboxamide (PubChem CID 68952134) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[(1R,5R)-6-(5-hydroxypentyl)-6-azabicyclo[3.2.1]octan-5-yl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[(1R,5R)-6-(5-hydroxypentyl)-6-azabicyclo[3.2.1]octan-5-yl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 68952134 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-[(1R,5R)-6-(5-hydroxypentyl)-6-azabicyclo[3.2.1]octan-5-yl]-1H-benzimidazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2[nH]c([C@]34CCC[C@@H](CN3CCCCCO)C4)nc12 |
| InChI | InChI=1S/C20H28N4O2/c21-18(26)15-7-4-8-16-17(15)23-19(22-16)20-9-5-6-14(12-20)13-24(20)10-2-1-3-11-25/h4,7-8,14,25H,1-3,5-6,9-13H2,(H2,21,26)(H,22,23)/t14-,20-/m1/s1 |
| InChIKey | FHBUHVUFJYTIEZ-JLTOFOAXSA-N |
| XLogP | 2.53 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|