C18H22N2O2 — CID 68952622
tert-butyl 3-(2-pyridin-3-ylethylamino)benzoate (PubChem CID 68952622) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is tert-butyl 3-(2-pyridin-3-ylethylamino)benzoate.
| Compound Name | tert-butyl 3-(2-pyridin-3-ylethylamino)benzoate |
|---|---|
| PubChem CID | 68952622 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | tert-butyl 3-(2-pyridin-3-ylethylamino)benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(NCCc2cccnc2)c1 |
| InChI | InChI=1S/C18H22N2O2/c1-18(2,3)22-17(21)15-7-4-8-16(12-15)20-11-9-14-6-5-10-19-13-14/h4-8,10,12-13,20H,9,11H2,1-3H3 |
| InChIKey | NJNYLQLHBLHJSH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |