C19H17F2N3OS — CID 68952643
1-[[4-(difluoromethylsulfanyl)phenyl]methyl]-3-(3-methylisoquinolin-5-yl)urea (PubChem CID 68952643) has the molecular formula C19H17F2N3OS and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-[[4-(difluoromethylsulfanyl)phenyl]methyl]-3-(3-methylisoquinolin-5-yl)urea.
| Compound Name | 1-[[4-(difluoromethylsulfanyl)phenyl]methyl]-3-(3-methylisoquinolin-5-yl)urea |
|---|---|
| PubChem CID | 68952643 |
| Molecular Formula | C19H17F2N3OS |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 1-[[4-(difluoromethylsulfanyl)phenyl]methyl]-3-(3-methylisoquinolin-5-yl)urea |
| SMILES | Cc1cc2c(NC(=O)NCc3ccc(SC(F)F)cc3)cccc2cn1 |
| InChI | InChI=1S/C19H17F2N3OS/c1-12-9-16-14(11-22-12)3-2-4-17(16)24-19(25)23-10-13-5-7-15(8-6-13)26-18(20)21/h2-9,11,18H,10H2,1H3,(H2,23,24,25) |
| InChIKey | LGRWNTIZUREONP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |