C28H27N5O2 — CID 68953216
N-[3-(4-benzylpiperazine-1-carbonyl)phenyl]-3-(1H-indazol-3-yl)prop-2-enamide (PubChem CID 68953216) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazine-1-carbonyl)phenyl]-3-(1H-indazol-3-yl)prop-2-enamide.
| Compound Name | N-[3-(4-benzylpiperazine-1-carbonyl)phenyl]-3-(1H-indazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 68953216 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[3-(4-benzylpiperazine-1-carbonyl)phenyl]-3-(1H-indazol-3-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1n[nH]c2ccccc12)Nc1cccc(C(=O)N2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C28H27N5O2/c34-27(14-13-26-24-11-4-5-12-25(24)30-31-26)29-23-10-6-9-22(19-23)28(35)33-17-15-32(16-18-33)20-21-7-2-1-3-8-21/h1-14,19H,15-18,20H2,(H,29,34)(H,30,31) |
| InChIKey | LNRDAZWJQZRGTJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|