C20H24N4O — CID 109223799
(4-benzylpiperazin-1-yl)-[5-(cyclopropylamino)-3-pyridinyl]methanone (PubChem CID 109223799) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[5-(cyclopropylamino)-3-pyridinyl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[5-(cyclopropylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 109223799 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[5-(cyclopropylamino)-3-pyridinyl]methanone |
| SMILES | O=C(c1cncc(NC2CC2)c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N4O/c25-20(17-12-19(14-21-13-17)22-18-6-7-18)24-10-8-23(9-11-24)15-16-4-2-1-3-5-16/h1-5,12-14,18,22H,6-11,15H2 |
| InChIKey | CDPOGBUSECMJKT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |