C23H28ClN3O2 — CID 68953307
1-[5-[4-(3-chlorophenyl)piperidine-1-carbonyl]-2-methylphenyl]-3-propan-2-ylurea (PubChem CID 68953307) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 1-[5-[4-(3-chlorophenyl)piperidine-1-carbonyl]-2-methylphenyl]-3-propan-2-ylurea.
| Compound Name | 1-[5-[4-(3-chlorophenyl)piperidine-1-carbonyl]-2-methylphenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 68953307 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-[5-[4-(3-chlorophenyl)piperidine-1-carbonyl]-2-methylphenyl]-3-propan-2-ylurea |
| SMILES | Cc1ccc(C(=O)N2CCC(c3cccc(Cl)c3)CC2)cc1NC(=O)NC(C)C |
| InChI | InChI=1S/C23H28ClN3O2/c1-15(2)25-23(29)26-21-14-19(8-7-16(21)3)22(28)27-11-9-17(10-12-27)18-5-4-6-20(24)13-18/h4-8,13-15,17H,9-12H2,1-3H3,(H2,25,26,29) |
| InChIKey | ZKYZXFCMODPXFE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |