C24H31N3O3 — CID 68954757
1-[5-[4-(3-methoxyphenyl)piperidine-1-carbonyl]-2-methylphenyl]-3-propan-2-ylurea (PubChem CID 68954757) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[5-[4-(3-methoxyphenyl)piperidine-1-carbonyl]-2-methylphenyl]-3-propan-2-ylurea.
| Compound Name | 1-[5-[4-(3-methoxyphenyl)piperidine-1-carbonyl]-2-methylphenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 68954757 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-[5-[4-(3-methoxyphenyl)piperidine-1-carbonyl]-2-methylphenyl]-3-propan-2-ylurea |
| SMILES | COc1cccc(C2CCN(C(=O)c3ccc(C)c(NC(=O)NC(C)C)c3)CC2)c1 |
| InChI | InChI=1S/C24H31N3O3/c1-16(2)25-24(29)26-22-15-20(9-8-17(22)3)23(28)27-12-10-18(11-13-27)19-6-5-7-21(14-19)30-4/h5-9,14-16,18H,10-13H2,1-4H3,(H2,25,26,29) |
| InChIKey | ABBHLLWUMUPZMH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |