C25H32FNO2 — CID 68957934
2-(4-fluorophenyl)-4-methyl-3-(phenylmethoxymethyl)-1-piperidin-1-ylpentan-1-one (PubChem CID 68957934) has the molecular formula C25H32FNO2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-methyl-3-(phenylmethoxymethyl)-1-piperidin-1-ylpentan-1-one.
| Compound Name | 2-(4-fluorophenyl)-4-methyl-3-(phenylmethoxymethyl)-1-piperidin-1-ylpentan-1-one |
|---|---|
| PubChem CID | 68957934 |
| Molecular Formula | C25H32FNO2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2-(4-fluorophenyl)-4-methyl-3-(phenylmethoxymethyl)-1-piperidin-1-ylpentan-1-one |
| SMILES | CC(C)C(COCc1ccccc1)C(C(=O)N1CCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H32FNO2/c1-19(2)23(18-29-17-20-9-5-3-6-10-20)24(21-11-13-22(26)14-12-21)25(28)27-15-7-4-8-16-27/h3,5-6,9-14,19,23-24H,4,7-8,15-18H2,1-2H3 |
| InChIKey | MQAXWDJCGKIMSI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |