C45H56N8O4 — CID 68963001
1-[1-[[3,5-di(propan-2-yloxy)phenyl]methyl]piperidin-4-yl]-1,2-bis[5-(4-methoxyphenyl)pyrimidin-2-yl]-2-piperidin-4-ylhydrazine (PubChem CID 68963001) has the molecular formula C45H56N8O4 and a molecular weight of 773.00 g/mol. Its IUPAC name is 1-[1-[[3,5-di(propan-2-yloxy)phenyl]methyl]piperidin-4-yl]-1,2-bis[5-(4-methoxyphenyl)pyrimidin-2-yl]-2-piperidin-4-ylhydrazine.
| Compound Name | 1-[1-[[3,5-di(propan-2-yloxy)phenyl]methyl]piperidin-4-yl]-1,2-bis[5-(4-methoxyphenyl)pyrimidin-2-yl]-2-piperidin-4-ylhydrazine |
|---|---|
| PubChem CID | 68963001 |
| Molecular Formula | C45H56N8O4 |
| Molecular Weight | 773.00 g/mol |
| Exact Mass | 772.44 |
| IUPAC Name | 1-[1-[[3,5-di(propan-2-yloxy)phenyl]methyl]piperidin-4-yl]-1,2-bis[5-(4-methoxyphenyl)pyrimidin-2-yl]-2-piperidin-4-ylhydrazine |
| SMILES | COc1ccc(-c2cnc(N(C3CCNCC3)N(c3ncc(-c4ccc(OC)cc4)cn3)C3CCN(Cc4cc(OC(C)C)cc(OC(C)C)c4)CC3)nc2)cc1 |
| InChI | InChI=1S/C45H56N8O4/c1-31(2)56-42-23-33(24-43(25-42)57-32(3)4)30-51-21-17-39(18-22-51)53(45-49-28-37(29-50-45)35-9-13-41(55-6)14-10-35)52(38-15-19-46-20-16-38)44-47-26-36(27-48-44)34-7-11-40(54-5)12-8-34/h7-14,23-29,31-32,38-39,46H,15-22,30H2,1-6H3 |
| InChIKey | CAWZDHMTZUHDOT-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.00 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|