C24H26N2O7 — CID 68964080
1-O-[[(3-amino-4-methylbenzoyl)-cyclopropylcarbamoyl]oxymethyl] 3-O-benzyl 2-methylpropanedioate (PubChem CID 68964080) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is 1-O-[[(3-amino-4-methylbenzoyl)-cyclopropylcarbamoyl]oxymethyl] 3-O-benzyl 2-methylpropanedioate.
| Compound Name | 1-O-[[(3-amino-4-methylbenzoyl)-cyclopropylcarbamoyl]oxymethyl] 3-O-benzyl 2-methylpropanedioate |
|---|---|
| PubChem CID | 68964080 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1-O-[[(3-amino-4-methylbenzoyl)-cyclopropylcarbamoyl]oxymethyl] 3-O-benzyl 2-methylpropanedioate |
| SMILES | Cc1ccc(C(=O)N(C(=O)OCOC(=O)C(C)C(=O)OCc2ccccc2)C2CC2)cc1N |
| InChI | InChI=1S/C24H26N2O7/c1-15-8-9-18(12-20(15)25)21(27)26(19-10-11-19)24(30)33-14-32-23(29)16(2)22(28)31-13-17-6-4-3-5-7-17/h3-9,12,16,19H,10-11,13-14,25H2,1-2H3 |
| InChIKey | IXVNHQIIFIBTRT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|