C14H22ClOSi — CID 68965144
CID 68965144 (PubChem CID 68965144) has the molecular formula C14H22ClOSi and a molecular weight of 269.87 g/mol.
| Compound Name | CID 68965144 |
|---|---|
| PubChem CID | 68965144 |
| Molecular Formula | C14H22ClOSi |
| Molecular Weight | 269.87 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | — |
| SMILES | C[Si](C)c1cc(C(C)(C)CCCl)ccc1CO |
| InChI | InChI=1S/C14H22ClOSi/c1-14(2,7-8-15)12-6-5-11(10-16)13(9-12)17(3)4/h5-6,9,16H,7-8,10H2,1-4H3 |
| InChIKey | IEIZEXQHMMEBPK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.87 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|