About 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile
4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile (PubChem CID 68968460) has the molecular formula C14H14N2OS
and a molecular weight of 258.35 g/mol. Its IUPAC name is 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile.
Molecular Properties
| Compound Name | 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile |
| PubChem CID | 68968460 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile |
| SMILES | C[C@@H]1[C@@H](O)CCN1c1ccc(C#N)c2sccc12 |
| InChI | InChI=1S/C14H14N2OS/c1-9-13(17)4-6-16(9)12-3-2-10(8-15)14-11(12)5-7-18-14/h2-3,5,7,9,13,17H,4,6H2,1H3/t9-,13+/m1/s1 |
| InChIKey | HBYAZWBIXNTTRA-RNCFNFMXSA-N |
| XLogP | 2.73 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile?
The IUPAC name of 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile (CID 68968460) is 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile.
What is the SMILES notation for 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile?
The canonical SMILES for 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile is C[C@@H]1[C@@H](O)CCN1c1ccc(C#N)c2sccc12.
What is the InChIKey of 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile?
The InChIKey is HBYAZWBIXNTTRA-RNCFNFMXSA-N. The full InChI is InChI=1S/C14H14N2OS/c1-9-13(17)4-6-16(9)12-3-2-10(8-15)14-11(12)5-7-18-14/h2-3,5,7,9,13,17H,4,6H2,1H3/t9-,13+/m1/s1.
What are the key properties of 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile?
4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile has a molecular weight of 258.35 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,3S)-3-hydroxy-2-methylpyrrolidin-1-yl]-1-benzothiophene-7-carbonitrile is sourced from PubChem (CID 68968460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).