C20H22FN5O3 — CID 68969614
1-[3-fluoro-5-[(1-oxo-3,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazin-5-yl)methyl]phenyl]-3-(6-methyl-3-pyridinyl)urea (PubChem CID 68969614) has the molecular formula C20H22FN5O3 and a molecular weight of 399.43 g/mol. Its IUPAC name is 1-[3-fluoro-5-[(1-oxo-3,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazin-5-yl)methyl]phenyl]-3-(6-methyl-3-pyridinyl)urea.
| Compound Name | 1-[3-fluoro-5-[(1-oxo-3,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazin-5-yl)methyl]phenyl]-3-(6-methyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 68969614 |
| Molecular Formula | C20H22FN5O3 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 1-[3-fluoro-5-[(1-oxo-3,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazin-5-yl)methyl]phenyl]-3-(6-methyl-3-pyridinyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(F)cc(CC3CNCC4C(=O)OCN34)c2)cn1 |
| InChI | InChI=1S/C20H22FN5O3/c1-12-2-3-15(8-23-12)24-20(28)25-16-5-13(4-14(21)7-16)6-17-9-22-10-18-19(27)29-11-26(17)18/h2-5,7-8,17-18,22H,6,9-11H2,1H3,(H2,24,25,28) |
| InChIKey | FXOFUCCYQMVMSS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |