C36H38N5O6+ — CID 68970896
[2-[(2-amino-2-oxoethyl)-[2-[naphthalen-2-yl-[2-(prop-1-ynylamino)acetyl]amino]acetyl]amino]acetyl]-bis(4-methoxyphenyl)-methylazanium (PubChem CID 68970896) has the molecular formula C36H38N5O6+ and a molecular weight of 636.73 g/mol. Its IUPAC name is [2-[(2-amino-2-oxoethyl)-[2-[naphthalen-2-yl-[2-(prop-1-ynylamino)acetyl]amino]acetyl]amino]acetyl]-bis(4-methoxyphenyl)-methylazanium.
| Compound Name | [2-[(2-amino-2-oxoethyl)-[2-[naphthalen-2-yl-[2-(prop-1-ynylamino)acetyl]amino]acetyl]amino]acetyl]-bis(4-methoxyphenyl)-methylazanium |
|---|---|
| PubChem CID | 68970896 |
| Molecular Formula | C36H38N5O6+ |
| Molecular Weight | 636.73 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | [2-[(2-amino-2-oxoethyl)-[2-[naphthalen-2-yl-[2-(prop-1-ynylamino)acetyl]amino]acetyl]amino]acetyl]-bis(4-methoxyphenyl)-methylazanium |
| SMILES | CC#CNCC(=O)N(CC(=O)N(CC(N)=O)CC(=O)[N+](C)(c1ccc(OC)cc1)c1ccc(OC)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H37N5O6/c1-5-20-38-22-34(43)40(28-11-10-26-8-6-7-9-27(26)21-28)24-35(44)39(23-33(37)42)25-36(45)41(2,29-12-16-31(46-3)17-13-29)30-14-18-32(47-4)19-15-30/h6-19,21,38H,22-25H2,1-4H3,(H-,37,42)/p+1 |
| InChIKey | PGFMFNJJTCUCLD-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|