C21H22N4O5 — CID 91515149
2-[[2-[(2-aminoacetyl)-naphthalen-2-ylamino]acetyl]-(2-amino-2-oxoethyl)amino]pent-3-ynoic acid (PubChem CID 91515149) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[[2-[(2-aminoacetyl)-naphthalen-2-ylamino]acetyl]-(2-amino-2-oxoethyl)amino]pent-3-ynoic acid.
| Compound Name | 2-[[2-[(2-aminoacetyl)-naphthalen-2-ylamino]acetyl]-(2-amino-2-oxoethyl)amino]pent-3-ynoic acid |
|---|---|
| PubChem CID | 91515149 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[[2-[(2-aminoacetyl)-naphthalen-2-ylamino]acetyl]-(2-amino-2-oxoethyl)amino]pent-3-ynoic acid |
| SMILES | CC#CC(C(=O)O)N(CC(N)=O)C(=O)CN(C(=O)CN)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H22N4O5/c1-2-5-17(21(29)30)25(12-18(23)26)20(28)13-24(19(27)11-22)16-9-8-14-6-3-4-7-15(14)10-16/h3-4,6-10,17H,11-13,22H2,1H3,(H2,23,26)(H,29,30) |
| InChIKey | PALWDLVUHPXBBQ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 147.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|