About 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide
4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide (PubChem CID 68972436) has the molecular formula C15H14N4O3
and a molecular weight of 298.30 g/mol. Its IUPAC name is 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide.
Molecular Properties
| Compound Name | 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide |
| PubChem CID | 68972436 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cccc3[nH]c(C(N)=O)nc23)o1 |
| InChI | InChI=1S/C15H14N4O3/c1-8-5-6-9(22-8)7-17-15(21)10-3-2-4-11-12(10)19-14(18-11)13(16)20/h2-6H,7H2,1H3,(H2,16,20)(H,17,21)(H,18,19) |
| InChIKey | XXAVRORKMAGSOC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide?
The IUPAC name of 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide (CID 68972436) is 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide.
What is the SMILES notation for 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide?
The canonical SMILES for 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide is Cc1ccc(CNC(=O)c2cccc3[nH]c(C(N)=O)nc23)o1.
What is the InChIKey of 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide?
The InChIKey is XXAVRORKMAGSOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O3/c1-8-5-6-9(22-8)7-17-15(21)10-3-2-4-11-12(10)19-14(18-11)13(16)20/h2-6H,7H2,1H3,(H2,16,20)(H,17,21)(H,18,19).
What are the key properties of 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide?
4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide has a molecular weight of 298.30 g/mol, XLogP of 1.49, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[(5-methylfuran-2-yl)methyl]-1H-benzimidazole-2,4-dicarboxamide is sourced from PubChem (CID 68972436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).