C19H16N2O — CID 68974055
4-[2-(6-ethyl-2-pyridinyl)ethynyl]-5-methyl-3-phenyl-1,2-oxazole (PubChem CID 68974055) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[2-(6-ethyl-2-pyridinyl)ethynyl]-5-methyl-3-phenyl-1,2-oxazole.
| Compound Name | 4-[2-(6-ethyl-2-pyridinyl)ethynyl]-5-methyl-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 68974055 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-[2-(6-ethyl-2-pyridinyl)ethynyl]-5-methyl-3-phenyl-1,2-oxazole |
| SMILES | CCc1cccc(C#Cc2c(-c3ccccc3)noc2C)n1 |
| InChI | InChI=1S/C19H16N2O/c1-3-16-10-7-11-17(20-16)12-13-18-14(2)22-21-19(18)15-8-5-4-6-9-15/h4-11H,3H2,1-2H3 |
| InChIKey | PZAGMGWDFKHGKK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|