C26H28N4O2 — CID 68980419
ethyl 3-[6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]naphthalen-2-yl]-1H-indazole-5-carboximidate (PubChem CID 68980419) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is ethyl 3-[6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]naphthalen-2-yl]-1H-indazole-5-carboximidate.
| Compound Name | ethyl 3-[6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]naphthalen-2-yl]-1H-indazole-5-carboximidate |
|---|---|
| PubChem CID | 68980419 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | ethyl 3-[6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]naphthalen-2-yl]-1H-indazole-5-carboximidate |
| SMILES | [H]/N=C(\OCC)c1ccc2[nH]nc(-c3ccc4cc(OC[C@@H]5CCCN5C)ccc4c3)c2c1 |
| InChI | InChI=1S/C26H28N4O2/c1-3-31-26(27)20-9-11-24-23(15-20)25(29-28-24)19-7-6-18-14-22(10-8-17(18)13-19)32-16-21-5-4-12-30(21)2/h6-11,13-15,21,27H,3-5,12,16H2,1-2H3,(H,28,29)/b27-26-/t21-/m0/s1 |
| InChIKey | YHJBBIYUTRYGKD-UMQBKLLPSA-N |
| XLogP | 5.22 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|