C8H14N2O2 — CID 68981384
3,5-diethoxy-4-methyl-1H-pyrazole (PubChem CID 68981384) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 3,5-diethoxy-4-methyl-1H-pyrazole.
| Compound Name | 3,5-diethoxy-4-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 68981384 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3,5-diethoxy-4-methyl-1H-pyrazole |
| SMILES | CCOc1n[nH]c(OCC)c1C |
| InChI | InChI=1S/C8H14N2O2/c1-4-11-7-6(3)8(10-9-7)12-5-2/h4-5H2,1-3H3,(H,9,10) |
| InChIKey | NTIBFHNJRXFTPC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |