C21H29N5O2 — CID 68982493
(2R)-2-amino-4-methyl-2-[2-(4-phenoxypiperidin-1-yl)pyrimidin-4-yl]pentanamide (PubChem CID 68982493) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-2-[2-(4-phenoxypiperidin-1-yl)pyrimidin-4-yl]pentanamide.
| Compound Name | (2R)-2-amino-4-methyl-2-[2-(4-phenoxypiperidin-1-yl)pyrimidin-4-yl]pentanamide |
|---|---|
| PubChem CID | 68982493 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (2R)-2-amino-4-methyl-2-[2-(4-phenoxypiperidin-1-yl)pyrimidin-4-yl]pentanamide |
| SMILES | CC(C)C[C@](N)(C(N)=O)c1ccnc(N2CCC(Oc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C21H29N5O2/c1-15(2)14-21(23,19(22)27)18-8-11-24-20(25-18)26-12-9-17(10-13-26)28-16-6-4-3-5-7-16/h3-8,11,15,17H,9-10,12-14,23H2,1-2H3,(H2,22,27)/t21-/m1/s1 |
| InChIKey | MBFPKJJMPMDISS-OAQYLSRUSA-N |
| XLogP | 2.21 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |