C20H26N4O3 — CID 135547509
2-methylpropyl N-[1-[4-(2-hydroxyphenyl)pyrimidin-2-yl]piperidin-4-yl]carbamate (PubChem CID 135547509) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-methylpropyl N-[1-[4-(2-hydroxyphenyl)pyrimidin-2-yl]piperidin-4-yl]carbamate.
| Compound Name | 2-methylpropyl N-[1-[4-(2-hydroxyphenyl)pyrimidin-2-yl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 135547509 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-methylpropyl N-[1-[4-(2-hydroxyphenyl)pyrimidin-2-yl]piperidin-4-yl]carbamate |
| SMILES | CC(C)COC(=O)NC1CCN(c2nccc(-c3ccccc3O)n2)CC1 |
| InChI | InChI=1S/C20H26N4O3/c1-14(2)13-27-20(26)22-15-8-11-24(12-9-15)19-21-10-7-17(23-19)16-5-3-4-6-18(16)25/h3-7,10,14-15,25H,8-9,11-13H2,1-2H3,(H,22,26) |
| InChIKey | RXOSWZJYGQGSPY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |