C12H11FN2O5 — CID 68983256
(6R)-6-(3-fluoro-5-nitrophenoxy)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 68983256) has the molecular formula C12H11FN2O5 and a molecular weight of 282.23 g/mol. Its IUPAC name is (6R)-6-(3-fluoro-5-nitrophenoxy)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (6R)-6-(3-fluoro-5-nitrophenoxy)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 68983256 |
| Molecular Formula | C12H11FN2O5 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (6R)-6-(3-fluoro-5-nitrophenoxy)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | O=C1OCC2C[C@@H](Oc3cc(F)cc([N+](=O)[O-])c3)CN12 |
| InChI | InChI=1S/C12H11FN2O5/c13-7-1-8(15(17)18)3-10(2-7)20-11-4-9-6-19-12(16)14(9)5-11/h1-3,9,11H,4-6H2/t9?,11-/m1/s1 |
| InChIKey | FIRKPESFXRMXAA-HCCKASOXSA-N |
| XLogP | 1.71 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|