C11H13FN2O4 — CID 68984308
[(2R,4S)-4-(3-fluoro-5-nitrophenoxy)pyrrolidin-2-yl]methanol (PubChem CID 68984308) has the molecular formula C11H13FN2O4 and a molecular weight of 256.23 g/mol. Its IUPAC name is [(2R,4S)-4-(3-fluoro-5-nitrophenoxy)pyrrolidin-2-yl]methanol.
| Compound Name | [(2R,4S)-4-(3-fluoro-5-nitrophenoxy)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 68984308 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [(2R,4S)-4-(3-fluoro-5-nitrophenoxy)pyrrolidin-2-yl]methanol |
| SMILES | O=[N+]([O-])c1cc(F)cc(O[C@@H]2CN[C@@H](CO)C2)c1 |
| InChI | InChI=1S/C11H13FN2O4/c12-7-1-9(14(16)17)4-10(2-7)18-11-3-8(6-15)13-5-11/h1-2,4,8,11,13,15H,3,5-6H2/t8-,11+/m1/s1 |
| InChIKey | RELGIGQYQKQPMM-KCJUWKMLSA-N |
| XLogP | 0.84 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|