C25H26FN7O2 — CID 68985177
7-[2-[3-fluoro-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]pyrimidin-4-yl]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 68985177) has the molecular formula C25H26FN7O2 and a molecular weight of 475.53 g/mol. Its IUPAC name is 7-[2-[3-fluoro-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]pyrimidin-4-yl]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 7-[2-[3-fluoro-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]pyrimidin-4-yl]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 68985177 |
| Molecular Formula | C25H26FN7O2 |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 7-[2-[3-fluoro-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]pyrimidin-4-yl]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CN1C[C@@H]2C[C@H]1CN2c1ccc(Nc2nccc(-c3cnc4c(c3)OC(C)(C)C(=O)N4)n2)cc1F |
| InChI | InChI=1S/C25H26FN7O2/c1-25(2)23(34)31-22-21(35-25)8-14(11-28-22)19-6-7-27-24(30-19)29-15-4-5-20(18(26)9-15)33-13-16-10-17(33)12-32(16)3/h4-9,11,16-17H,10,12-13H2,1-3H3,(H,27,29,30)(H,28,31,34)/t16-,17-/m0/s1 |
| InChIKey | YASNXRXQQCNNNH-IRXDYDNUSA-N |
| XLogP | 3.42 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |