C17H16FN3O4 — CID 68986049
ethyl 4-[2-(4-fluorophenyl)ethyl]-5,7-dioxopyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 68986049) has the molecular formula C17H16FN3O4 and a molecular weight of 345.33 g/mol. Its IUPAC name is ethyl 4-[2-(4-fluorophenyl)ethyl]-5,7-dioxopyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | ethyl 4-[2-(4-fluorophenyl)ethyl]-5,7-dioxopyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 68986049 |
| Molecular Formula | C17H16FN3O4 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | ethyl 4-[2-(4-fluorophenyl)ethyl]-5,7-dioxopyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2n(n1)C(=O)CC(=O)N2CCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN3O4/c1-2-25-17(24)13-9-14-20(15(22)10-16(23)21(14)19-13)8-7-11-3-5-12(18)6-4-11/h3-6,9H,2,7-8,10H2,1H3 |
| InChIKey | IRCLAFGVTZQDIX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|