C36H37N5O7 — CID 68987371
(3R)-3-benzyl-4-[1-[(1S,2R)-2-(4-nitrobenzoyl)oxycycloheptyl]-5-phenylimidazole-4-carbonyl]piperazine-1-carboxylic acid (PubChem CID 68987371) has the molecular formula C36H37N5O7 and a molecular weight of 651.72 g/mol. Its IUPAC name is (3R)-3-benzyl-4-[1-[(1S,2R)-2-(4-nitrobenzoyl)oxycycloheptyl]-5-phenylimidazole-4-carbonyl]piperazine-1-carboxylic acid.
| Compound Name | (3R)-3-benzyl-4-[1-[(1S,2R)-2-(4-nitrobenzoyl)oxycycloheptyl]-5-phenylimidazole-4-carbonyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68987371 |
| Molecular Formula | C36H37N5O7 |
| Molecular Weight | 651.72 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | (3R)-3-benzyl-4-[1-[(1S,2R)-2-(4-nitrobenzoyl)oxycycloheptyl]-5-phenylimidazole-4-carbonyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O[C@@H]1CCCCC[C@@H]1n1cnc(C(=O)N2CCN(C(=O)O)C[C@H]2Cc2ccccc2)c1-c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C36H37N5O7/c42-34(39-21-20-38(36(44)45)23-29(39)22-25-10-4-1-5-11-25)32-33(26-12-6-2-7-13-26)40(24-37-32)30-14-8-3-9-15-31(30)48-35(43)27-16-18-28(19-17-27)41(46)47/h1-2,4-7,10-13,16-19,24,29-31H,3,8-9,14-15,20-23H2,(H,44,45)/t29-,30+,31-/m1/s1 |
| InChIKey | NZMGGCCKEPGCOO-MJSOWUPRSA-N |
| XLogP | 6.24 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.72 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|