C35H35N5O7 — CID 68989587
(3R)-3-benzyl-4-[1-[(1S,2R)-2-(4-nitrobenzoyl)oxycyclohexyl]-5-phenylimidazole-4-carbonyl]piperazine-1-carboxylic acid (PubChem CID 68989587) has the molecular formula C35H35N5O7 and a molecular weight of 637.69 g/mol. Its IUPAC name is (3R)-3-benzyl-4-[1-[(1S,2R)-2-(4-nitrobenzoyl)oxycyclohexyl]-5-phenylimidazole-4-carbonyl]piperazine-1-carboxylic acid.
| Compound Name | (3R)-3-benzyl-4-[1-[(1S,2R)-2-(4-nitrobenzoyl)oxycyclohexyl]-5-phenylimidazole-4-carbonyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68989587 |
| Molecular Formula | C35H35N5O7 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | (3R)-3-benzyl-4-[1-[(1S,2R)-2-(4-nitrobenzoyl)oxycyclohexyl]-5-phenylimidazole-4-carbonyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O[C@@H]1CCCC[C@@H]1n1cnc(C(=O)N2CCN(C(=O)O)C[C@H]2Cc2ccccc2)c1-c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H35N5O7/c41-33(38-20-19-37(35(43)44)22-28(38)21-24-9-3-1-4-10-24)31-32(25-11-5-2-6-12-25)39(23-36-31)29-13-7-8-14-30(29)47-34(42)26-15-17-27(18-16-26)40(45)46/h1-6,9-12,15-18,23,28-30H,7-8,13-14,19-22H2,(H,43,44)/t28-,29+,30-/m1/s1 |
| InChIKey | IEVJLIUNEKGJND-DYIKCSJPSA-N |
| XLogP | 5.85 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|