C24H24O3 — CID 68987704
4-(2-methoxyethenyl)-1-[(4-methoxyphenyl)methyl]-2-phenylmethoxybenzene (PubChem CID 68987704) has the molecular formula C24H24O3 and a molecular weight of 360.45 g/mol. Its IUPAC name is 4-(2-methoxyethenyl)-1-[(4-methoxyphenyl)methyl]-2-phenylmethoxybenzene.
| Compound Name | 4-(2-methoxyethenyl)-1-[(4-methoxyphenyl)methyl]-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 68987704 |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-(2-methoxyethenyl)-1-[(4-methoxyphenyl)methyl]-2-phenylmethoxybenzene |
| SMILES | COC=Cc1ccc(Cc2ccc(OC)cc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H24O3/c1-25-15-14-20-8-11-22(16-19-9-12-23(26-2)13-10-19)24(17-20)27-18-21-6-4-3-5-7-21/h3-15,17H,16,18H2,1-2H3 |
| InChIKey | YTKWEUCEUDEKFW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|