C27H37N3O6 — CID 68988156
4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(3-ethoxycarbonyl-2-methylpyrrol-1-yl)ethyl]piperazine-1,4-dicarboxylate (PubChem CID 68988156) has the molecular formula C27H37N3O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(3-ethoxycarbonyl-2-methylpyrrol-1-yl)ethyl]piperazine-1,4-dicarboxylate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(3-ethoxycarbonyl-2-methylpyrrol-1-yl)ethyl]piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 68988156 |
| Molecular Formula | C27H37N3O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl (2R)-2-[2-(3-ethoxycarbonyl-2-methylpyrrol-1-yl)ethyl]piperazine-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1ccn(CC[C@@H]2CN(C(=O)OCc3ccccc3)CCN2C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C27H37N3O6/c1-6-34-24(31)23-13-15-28(20(23)2)14-12-22-18-29(16-17-30(22)26(33)36-27(3,4)5)25(32)35-19-21-10-8-7-9-11-21/h7-11,13,15,22H,6,12,14,16-19H2,1-5H3/t22-/m1/s1 |
| InChIKey | LDWSYJSRCMIYAH-JOCHJYFZSA-N |
| XLogP | 4.62 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|