C11H11F3N2O3 — CID 68988557
[(4R)-8-(trifluoromethoxy)-3,4-dihydro-2H-chromen-4-yl]urea (PubChem CID 68988557) has the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. Its IUPAC name is [(4R)-8-(trifluoromethoxy)-3,4-dihydro-2H-chromen-4-yl]urea.
| Compound Name | [(4R)-8-(trifluoromethoxy)-3,4-dihydro-2H-chromen-4-yl]urea |
|---|---|
| PubChem CID | 68988557 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [(4R)-8-(trifluoromethoxy)-3,4-dihydro-2H-chromen-4-yl]urea |
| SMILES | NC(=O)N[C@@H]1CCOc2c(OC(F)(F)F)cccc21 |
| InChI | InChI=1S/C11H11F3N2O3/c12-11(13,14)19-8-3-1-2-6-7(16-10(15)17)4-5-18-9(6)8/h1-3,7H,4-5H2,(H3,15,16,17)/t7-/m1/s1 |
| InChIKey | UREITABJDDCLQD-SSDOTTSWSA-N |
| XLogP | 2.08 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |