C18H23N3OS — CID 68991918
2-[4-[2-(aminomethyl)pyrrolidin-1-yl]phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol (PubChem CID 68991918) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-[4-[2-(aminomethyl)pyrrolidin-1-yl]phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol.
| Compound Name | 2-[4-[2-(aminomethyl)pyrrolidin-1-yl]phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
|---|---|
| PubChem CID | 68991918 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[4-[2-(aminomethyl)pyrrolidin-1-yl]phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
| SMILES | NCC1CCCN1c1ccc(-c2nc3c(s2)C(O)CCC3)cc1 |
| InChI | InChI=1S/C18H23N3OS/c19-11-14-3-2-10-21(14)13-8-6-12(7-9-13)18-20-15-4-1-5-16(22)17(15)23-18/h6-9,14,16,22H,1-5,10-11,19H2 |
| InChIKey | FSVHVPHIBIGSJF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|