C24H34N6O10 — CID 68992538
bis[(1R)-1-(4-ethoxycarbonyl-1-methylpyrazol-5-yl)oxyethyl] piperazine-1,4-dicarboxylate (PubChem CID 68992538) has the molecular formula C24H34N6O10 and a molecular weight of 566.57 g/mol. Its IUPAC name is bis[(1R)-1-(4-ethoxycarbonyl-1-methylpyrazol-5-yl)oxyethyl] piperazine-1,4-dicarboxylate.
| Compound Name | bis[(1R)-1-(4-ethoxycarbonyl-1-methylpyrazol-5-yl)oxyethyl] piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 68992538 |
| Molecular Formula | C24H34N6O10 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | bis[(1R)-1-(4-ethoxycarbonyl-1-methylpyrazol-5-yl)oxyethyl] piperazine-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1O[C@@H](C)OC(=O)N1CCN(C(=O)O[C@H](C)Oc2c(C(=O)OCC)cnn2C)CC1 |
| InChI | InChI=1S/C24H34N6O10/c1-7-35-21(31)17-13-25-27(5)19(17)37-15(3)39-23(33)29-9-11-30(12-10-29)24(34)40-16(4)38-20-18(14-26-28(20)6)22(32)36-8-2/h13-16H,7-12H2,1-6H3/t15-,16-/m1/s1 |
| InChIKey | YQZURHVCJSFTJX-HZPDHXFCSA-N |
| XLogP | 1.55 |
| TPSA | 165.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|