C18H17NO — CID 68993987
4-(1-benzofuran-2-yl)-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 68993987) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 4-(1-benzofuran-2-yl)-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 68993987 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1Cc2ccccc2C(c2cc3ccccc3o2)C1 |
| InChI | InChI=1S/C18H17NO/c1-19-11-14-7-2-4-8-15(14)16(12-19)18-10-13-6-3-5-9-17(13)20-18/h2-10,16H,11-12H2,1H3 |
| InChIKey | HXJTYROTEDEIBT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |